About triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate
triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate (PubChem CID 175305307) has the molecular formula C24H44O9Si
and a molecular weight of 504.69 g/mol. Its IUPAC name is triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate.
Molecular Properties
| Compound Name | triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate |
| PubChem CID | 175305307 |
| Molecular Formula | C24H44O9Si |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate |
| SMILES | CCO[Si](OCC)(OCC)OCCOCCOCCOCCOCCOCCc1ccccc1 |
| InChI | InChI=1S/C24H44O9Si/c1-4-30-34(31-5-2,32-6-3)33-23-22-29-21-20-28-19-18-27-17-16-26-15-14-25-13-12-24-10-8-7-9-11-24/h7-11H,4-6,12-23H2,1-3H3 |
| InChIKey | DAHYGYDFZNBYMK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate?
The IUPAC name of triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate (CID 175305307) is triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate.
What is the SMILES notation for triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate?
The canonical SMILES for triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate is CCO[Si](OCC)(OCC)OCCOCCOCCOCCOCCOCCc1ccccc1.
What is the InChIKey of triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate?
The InChIKey is DAHYGYDFZNBYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O9Si/c1-4-30-34(31-5-2,32-6-3)33-23-22-29-21-20-28-19-18-27-17-16-26-15-14-25-13-12-24-10-8-7-9-11-24/h7-11H,4-6,12-23H2,1-3H3.
What are the key properties of triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate?
triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate has a molecular weight of 504.69 g/mol, XLogP of 2.87, 25 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl 2-[2-[2-[2-[2-(2-phenylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl silicate is sourced from PubChem (CID 175305307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).