C26H19N3O4S — CID 175305417
2,6-bis(1-oxo-3,4-dihydroisoquinolin-2-yl)-1,3-benzothiazole-5-carboxylic acid (PubChem CID 175305417) has the molecular formula C26H19N3O4S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2,6-bis(1-oxo-3,4-dihydroisoquinolin-2-yl)-1,3-benzothiazole-5-carboxylic acid.
| Compound Name | 2,6-bis(1-oxo-3,4-dihydroisoquinolin-2-yl)-1,3-benzothiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 175305417 |
| Molecular Formula | C26H19N3O4S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2,6-bis(1-oxo-3,4-dihydroisoquinolin-2-yl)-1,3-benzothiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2nc(N3CCc4ccccc4C3=O)sc2cc1N1CCc2ccccc2C1=O |
| InChI | InChI=1S/C26H19N3O4S/c30-23-17-7-3-1-5-15(17)9-11-28(23)21-14-22-20(13-19(21)25(32)33)27-26(34-22)29-12-10-16-6-2-4-8-18(16)24(29)31/h1-8,13-14H,9-12H2,(H,32,33) |
| InChIKey | XDJQPTWNWQLAIU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |