About 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane
3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane (PubChem CID 175305941) has the molecular formula C17H21F3O3S
and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane.
Molecular Properties
| Compound Name | 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| PubChem CID | 175305941 |
| Molecular Formula | C17H21F3O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| SMILES | CC1COC(C)(S(=O)(=O)c2cccc(C(F)(F)F)c2)C(C2CC2)C1 |
| InChI | InChI=1S/C17H21F3O3S/c1-11-8-15(12-6-7-12)16(2,23-10-11)24(21,22)14-5-3-4-13(9-14)17(18,19)20/h3-5,9,11-12,15H,6-8,10H2,1-2H3 |
| InChIKey | WDJHCRKWXAOOAV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane?
The IUPAC name of 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane (CID 175305941) is 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane.
What is the SMILES notation for 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane?
The canonical SMILES for 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane is CC1COC(C)(S(=O)(=O)c2cccc(C(F)(F)F)c2)C(C2CC2)C1.
What is the InChIKey of 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane?
The InChIKey is WDJHCRKWXAOOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F3O3S/c1-11-8-15(12-6-7-12)16(2,23-10-11)24(21,22)14-5-3-4-13(9-14)17(18,19)20/h3-5,9,11-12,15H,6-8,10H2,1-2H3.
What are the key properties of 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane?
3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane has a molecular weight of 362.41 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-2,5-dimethyl-2-[3-(trifluoromethyl)phenyl]sulfonyloxane is sourced from PubChem (CID 175305941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).