About 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid
2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid (PubChem CID 175306062) has the molecular formula C7H18N2O6S
and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid.
Molecular Properties
| Compound Name | 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid |
| PubChem CID | 175306062 |
| Molecular Formula | C7H18N2O6S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid |
| SMILES | CN(C)CC(O)CS(=O)(=O)O.NCC(=O)O |
| InChI | InChI=1S/C5H13NO4S.C2H5NO2/c1-6(2)3-5(7)4-11(8,9)10;3-1-2(4)5/h5,7H,3-4H2,1-2H3,(H,8,9,10);1,3H2,(H,4,5) |
| InChIKey | DMDJAEGTPRKSNP-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid?
The IUPAC name of 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid (CID 175306062) is 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid.
What is the SMILES notation for 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid?
The canonical SMILES for 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid is CN(C)CC(O)CS(=O)(=O)O.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid?
The InChIKey is DMDJAEGTPRKSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO4S.C2H5NO2/c1-6(2)3-5(7)4-11(8,9)10;3-1-2(4)5/h5,7H,3-4H2,1-2H3,(H,8,9,10);1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid?
2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid has a molecular weight of 258.30 g/mol, XLogP of -2.17, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;3-(dimethylamino)-2-hydroxypropane-1-sulfonic acid is sourced from PubChem (CID 175306062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).