About [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride
[4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride (PubChem CID 175306117) has the molecular formula C11H19ClF3NO2
and a molecular weight of 289.72 g/mol. Its IUPAC name is [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride |
| PubChem CID | 175306117 |
| Molecular Formula | C11H19ClF3NO2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride |
| SMILES | CC(N)C(=O)OCC1CCC(C(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C11H18F3NO2.ClH/c1-7(15)10(16)17-6-8-2-4-9(5-3-8)11(12,13)14;/h7-9H,2-6,15H2,1H3;1H |
| InChIKey | GEXTZNJZYQTNSP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride?
The IUPAC name of [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride (CID 175306117) is [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride.
What is the SMILES notation for [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride?
The canonical SMILES for [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride is CC(N)C(=O)OCC1CCC(C(F)(F)F)CC1.Cl.
What is the InChIKey of [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride?
The InChIKey is GEXTZNJZYQTNSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2.ClH/c1-7(15)10(16)17-6-8-2-4-9(5-3-8)11(12,13)14;/h7-9H,2-6,15H2,1H3;1H.
What are the key properties of [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride?
[4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride has a molecular weight of 289.72 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)cyclohexyl]methyl 2-aminopropanoate;hydrochloride is sourced from PubChem (CID 175306117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).