C5H6F3NOS — CID 175306402
2-(1,2,2-trifluoroethyl)-1,3-thiazolidin-4-one (PubChem CID 175306402) has the molecular formula C5H6F3NOS and a molecular weight of 185.17 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(1,2,2-trifluoroethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 175306402 |
| Molecular Formula | C5H6F3NOS |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 2-(1,2,2-trifluoroethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(C(F)C(F)F)N1 |
| InChI | InChI=1S/C5H6F3NOS/c6-3(4(7)8)5-9-2(10)1-11-5/h3-5H,1H2,(H,9,10) |
| InChIKey | TUXDATLAZZPINP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |