C15H31N2+ — CID 175307067
2,5-dibutyl-1-ethyl-1,3-dimethyl-2H-imidazol-1-ium (PubChem CID 175307067) has the molecular formula C15H31N2+ and a molecular weight of 239.43 g/mol. Its IUPAC name is 2,5-dibutyl-1-ethyl-1,3-dimethyl-2H-imidazol-1-ium.
| Compound Name | 2,5-dibutyl-1-ethyl-1,3-dimethyl-2H-imidazol-1-ium |
|---|---|
| PubChem CID | 175307067 |
| Molecular Formula | C15H31N2+ |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.25 |
| IUPAC Name | 2,5-dibutyl-1-ethyl-1,3-dimethyl-2H-imidazol-1-ium |
| SMILES | CCCCC1=CN(C)C(CCCC)[N+]1(C)CC |
| InChI | InChI=1S/C15H31N2/c1-6-9-11-14-13-16(4)15(12-10-7-2)17(14,5)8-3/h13,15H,6-12H2,1-5H3/q+1 |
| InChIKey | HQSAEKYPJLATMD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|