C8H12N2O2 — CID 175308246
3-(2,2-dimethoxyethyl)pyridazine (PubChem CID 175308246) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)pyridazine.
| Compound Name | 3-(2,2-dimethoxyethyl)pyridazine |
|---|---|
| PubChem CID | 175308246 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)pyridazine |
| SMILES | COC(Cc1cccnn1)OC |
| InChI | InChI=1S/C8H12N2O2/c1-11-8(12-2)6-7-4-3-5-9-10-7/h3-5,8H,6H2,1-2H3 |
| InChIKey | FXPUXAHNTSBAKS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|