About 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide
2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide (PubChem CID 175308251) has the molecular formula C11H15ClFNO3
and a molecular weight of 263.70 g/mol. Its IUPAC name is 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide |
| PubChem CID | 175308251 |
| Molecular Formula | C11H15ClFNO3 |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide |
| SMILES | COCCOC1(F)C=CC(Cl)=CC1CC(N)=O |
| InChI | InChI=1S/C11H15ClFNO3/c1-16-4-5-17-11(13)3-2-9(12)6-8(11)7-10(14)15/h2-3,6,8H,4-5,7H2,1H3,(H2,14,15) |
| InChIKey | DDOMMVDLCAPITI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide?
The IUPAC name of 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide (CID 175308251) is 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide.
What is the SMILES notation for 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide?
The canonical SMILES for 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide is COCCOC1(F)C=CC(Cl)=CC1CC(N)=O.
What is the InChIKey of 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide?
The InChIKey is DDOMMVDLCAPITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClFNO3/c1-16-4-5-17-11(13)3-2-9(12)6-8(11)7-10(14)15/h2-3,6,8H,4-5,7H2,1H3,(H2,14,15).
What are the key properties of 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide?
2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide has a molecular weight of 263.70 g/mol, XLogP of 1.50, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-chloro-6-fluoro-6-(2-methoxyethoxy)cyclohexa-2,4-dien-1-yl]acetamide is sourced from PubChem (CID 175308251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).