About butan-2-ylpentasilolane
butan-2-ylpentasilolane (PubChem CID 175308763) has the molecular formula C4H18Si5
and a molecular weight of 206.62 g/mol. Its IUPAC name is butan-2-ylpentasilolane.
Molecular Properties
| Compound Name | butan-2-ylpentasilolane |
| PubChem CID | 175308763 |
| Molecular Formula | C4H18Si5 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | butan-2-ylpentasilolane |
| SMILES | CCC(C)[SiH]1[SiH2][SiH2][SiH2][SiH2]1 |
| InChI | InChI=1S/C4H18Si5/c1-3-4(2)9-7-5-6-8-9/h4,9H,3,5-8H2,1-2H3 |
| InChIKey | XWBZMYWZWAGEFM-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylpentasilolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylpentasilolane?
The IUPAC name of butan-2-ylpentasilolane (CID 175308763) is butan-2-ylpentasilolane.
What is the SMILES notation for butan-2-ylpentasilolane?
The canonical SMILES for butan-2-ylpentasilolane is CCC(C)[SiH]1[SiH2][SiH2][SiH2][SiH2]1.
What is the InChIKey of butan-2-ylpentasilolane?
The InChIKey is XWBZMYWZWAGEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H18Si5/c1-3-4(2)9-7-5-6-8-9/h4,9H,3,5-8H2,1-2H3.
What are the key properties of butan-2-ylpentasilolane?
butan-2-ylpentasilolane has a molecular weight of 206.62 g/mol, XLogP of -2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylpentasilolane is sourced from PubChem (CID 175308763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).