C8H9ClN2O4S — CID 175309574
(5-chloro-3-methylsulfonyl-2-pyridinyl)methyl carbamate (PubChem CID 175309574) has the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. Its IUPAC name is (5-chloro-3-methylsulfonyl-2-pyridinyl)methyl carbamate.
| Compound Name | (5-chloro-3-methylsulfonyl-2-pyridinyl)methyl carbamate |
|---|---|
| PubChem CID | 175309574 |
| Molecular Formula | C8H9ClN2O4S |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (5-chloro-3-methylsulfonyl-2-pyridinyl)methyl carbamate |
| SMILES | CS(=O)(=O)c1cc(Cl)cnc1COC(N)=O |
| InChI | InChI=1S/C8H9ClN2O4S/c1-16(13,14)7-2-5(9)3-11-6(7)4-15-8(10)12/h2-3H,4H2,1H3,(H2,10,12) |
| InChIKey | QWYNYJMKCZTIBG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |