About 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid
2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid (PubChem CID 175309731) has the molecular formula C12H23F2NO4S
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid.
Molecular Properties
| Compound Name | 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid |
| PubChem CID | 175309731 |
| Molecular Formula | C12H23F2NO4S |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid |
| SMILES | CCCCCCCCS(=O)(=O)N(CC)C(F)(F)C(=O)O |
| InChI | InChI=1S/C12H23F2NO4S/c1-3-5-6-7-8-9-10-20(18,19)15(4-2)12(13,14)11(16)17/h3-10H2,1-2H3,(H,16,17) |
| InChIKey | PFQFYRWSUWTPCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid?
The IUPAC name of 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid (CID 175309731) is 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid.
What is the SMILES notation for 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid?
The canonical SMILES for 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid is CCCCCCCCS(=O)(=O)N(CC)C(F)(F)C(=O)O.
What is the InChIKey of 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid?
The InChIKey is PFQFYRWSUWTPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2NO4S/c1-3-5-6-7-8-9-10-20(18,19)15(4-2)12(13,14)11(16)17/h3-10H2,1-2H3,(H,16,17).
What are the key properties of 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid?
2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid has a molecular weight of 315.38 g/mol, XLogP of 2.68, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(octylsulfonyl)amino]-2,2-difluoroacetic acid is sourced from PubChem (CID 175309731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).