About 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole
1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole (PubChem CID 175310156) has the molecular formula C12H8Cl2N2
and a molecular weight of 251.12 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole.
Molecular Properties
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole |
| PubChem CID | 175310156 |
| Molecular Formula | C12H8Cl2N2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole |
| SMILES | C#Cc1cn(Cc2cccc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C12H8Cl2N2/c1-2-10-7-16(8-15-10)6-9-4-3-5-11(13)12(9)14/h1,3-5,7-8H,6H2 |
| InChIKey | QRYGJUDZVRPMIK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole?
The IUPAC name of 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole (CID 175310156) is 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole.
What is the SMILES notation for 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole?
The canonical SMILES for 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole is C#Cc1cn(Cc2cccc(Cl)c2Cl)cn1.
What is the InChIKey of 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole?
The InChIKey is QRYGJUDZVRPMIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2/c1-2-10-7-16(8-15-10)6-9-4-3-5-11(13)12(9)14/h1,3-5,7-8H,6H2.
What are the key properties of 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole?
1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole has a molecular weight of 251.12 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-dichlorophenyl)methyl]-4-ethynylimidazole is sourced from PubChem (CID 175310156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).