C15H15NO4 — CID 175310261
[4-(1,4-dioxan-2-yl)quinolin-2-yl]methyl formate (PubChem CID 175310261) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is [4-(1,4-dioxan-2-yl)quinolin-2-yl]methyl formate.
| Compound Name | [4-(1,4-dioxan-2-yl)quinolin-2-yl]methyl formate |
|---|---|
| PubChem CID | 175310261 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [4-(1,4-dioxan-2-yl)quinolin-2-yl]methyl formate |
| SMILES | O=COCc1cc(C2COCCO2)c2ccccc2n1 |
| InChI | InChI=1S/C15H15NO4/c17-10-19-8-11-7-13(15-9-18-5-6-20-15)12-3-1-2-4-14(12)16-11/h1-4,7,10,15H,5-6,8-9H2 |
| InChIKey | ILDVCBYQMMJKHN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|