About cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol
cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol (PubChem CID 175310515) has the molecular formula C19H14O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol |
| PubChem CID | 175310515 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol |
| SMILES | O=C1C=CC(=O)C=C1.OC1C=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H10O.C6H4O2/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10;7-5-1-2-6(8)4-3-5/h1-8,12,14H;1-4H |
| InChIKey | WLJIFMJDGJIRMZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol?
The IUPAC name of cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol (CID 175310515) is cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol?
The canonical SMILES for cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol is O=C1C=CC(=O)C=C1.OC1C=Cc2cccc3cccc1c23.
What is the InChIKey of cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol?
The InChIKey is WLJIFMJDGJIRMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C6H4O2/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10;7-5-1-2-6(8)4-3-5/h1-8,12,14H;1-4H.
What are the key properties of cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol?
cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol has a molecular weight of 290.32 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-dione;1H-phenalen-1-ol is sourced from PubChem (CID 175310515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).