About hafnium;2-propan-2-ylcyclopenta-1,3-diene
hafnium;2-propan-2-ylcyclopenta-1,3-diene (PubChem CID 175311105) has the molecular formula C8H12Hf
and a molecular weight of 286.67 g/mol. Its IUPAC name is hafnium;2-propan-2-ylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | hafnium;2-propan-2-ylcyclopenta-1,3-diene |
| PubChem CID | 175311105 |
| Molecular Formula | C8H12Hf |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | hafnium;2-propan-2-ylcyclopenta-1,3-diene |
| SMILES | CC(C)C1=CCC=C1.[Hf] |
| InChI | InChI=1S/C8H12.Hf/c1-7(2)8-5-3-4-6-8;/h3,5-7H,4H2,1-2H3; |
| InChIKey | KWEFWCDLORPZCD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hafnium;2-propan-2-ylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;2-propan-2-ylcyclopenta-1,3-diene?
The IUPAC name of hafnium;2-propan-2-ylcyclopenta-1,3-diene (CID 175311105) is hafnium;2-propan-2-ylcyclopenta-1,3-diene.
What is the SMILES notation for hafnium;2-propan-2-ylcyclopenta-1,3-diene?
The canonical SMILES for hafnium;2-propan-2-ylcyclopenta-1,3-diene is CC(C)C1=CCC=C1.[Hf].
What is the InChIKey of hafnium;2-propan-2-ylcyclopenta-1,3-diene?
The InChIKey is KWEFWCDLORPZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.Hf/c1-7(2)8-5-3-4-6-8;/h3,5-7H,4H2,1-2H3;.
What are the key properties of hafnium;2-propan-2-ylcyclopenta-1,3-diene?
hafnium;2-propan-2-ylcyclopenta-1,3-diene has a molecular weight of 286.67 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;2-propan-2-ylcyclopenta-1,3-diene is sourced from PubChem (CID 175311105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).