About 1-formamidoethyl benzoate
1-formamidoethyl benzoate (PubChem CID 175311780) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 1-formamidoethyl benzoate.
Molecular Properties
| Compound Name | 1-formamidoethyl benzoate |
| PubChem CID | 175311780 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 1-formamidoethyl benzoate |
| SMILES | CC(NC=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c1-8(11-7-12)14-10(13)9-5-3-2-4-6-9/h2-8H,1H3,(H,11,12) |
| InChIKey | UQFHSHXPSWPGRL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-formamidoethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-formamidoethyl benzoate?
The IUPAC name of 1-formamidoethyl benzoate (CID 175311780) is 1-formamidoethyl benzoate.
What is the SMILES notation for 1-formamidoethyl benzoate?
The canonical SMILES for 1-formamidoethyl benzoate is CC(NC=O)OC(=O)c1ccccc1.
What is the InChIKey of 1-formamidoethyl benzoate?
The InChIKey is UQFHSHXPSWPGRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-8(11-7-12)14-10(13)9-5-3-2-4-6-9/h2-8H,1H3,(H,11,12).
What are the key properties of 1-formamidoethyl benzoate?
1-formamidoethyl benzoate has a molecular weight of 193.20 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-formamidoethyl benzoate is sourced from PubChem (CID 175311780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).