About 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile
2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile (PubChem CID 175312053) has the molecular formula C16H21BrN2OS
and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile.
Molecular Properties
| Compound Name | 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile |
| PubChem CID | 175312053 |
| Molecular Formula | C16H21BrN2OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile |
| SMILES | CC1(C)C=C(C(C#N)S(C)(C)(C)=O)c2ccc(Br)cc2N1 |
| InChI | InChI=1S/C16H21BrN2OS/c1-16(2)9-13(15(10-18)21(3,4,5)20)12-7-6-11(17)8-14(12)19-16/h6-9,15,19H,1-5H3 |
| InChIKey | PKBPTCNRJNHNCN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile?
The IUPAC name of 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile (CID 175312053) is 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile.
What is the SMILES notation for 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile?
The canonical SMILES for 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile is CC1(C)C=C(C(C#N)S(C)(C)(C)=O)c2ccc(Br)cc2N1.
What is the InChIKey of 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile?
The InChIKey is PKBPTCNRJNHNCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrN2OS/c1-16(2)9-13(15(10-18)21(3,4,5)20)12-7-6-11(17)8-14(12)19-16/h6-9,15,19H,1-5H3.
What are the key properties of 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile?
2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile has a molecular weight of 369.33 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-2,2-dimethyl-1H-quinolin-4-yl)-2-[trimethyl(oxo)-λ6-sulfanyl]acetonitrile is sourced from PubChem (CID 175312053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).