C19H30F6NO3S+ — CID 175313038
fluoro 1,1,7,7,7-pentafluoroheptane-1-sulfonate;tetrakis(prop-2-enyl)azanium (PubChem CID 175313038) has the molecular formula C19H30F6NO3S+ and a molecular weight of 466.51 g/mol. Its IUPAC name is fluoro 1,1,7,7,7-pentafluoroheptane-1-sulfonate;tetrakis(prop-2-enyl)azanium.
| Compound Name | fluoro 1,1,7,7,7-pentafluoroheptane-1-sulfonate;tetrakis(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 175313038 |
| Molecular Formula | C19H30F6NO3S+ |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | fluoro 1,1,7,7,7-pentafluoroheptane-1-sulfonate;tetrakis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(CC=C)CC=C.O=S(=O)(OF)C(F)(F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C12H20N.C7H10F6O3S/c1-5-9-13(10-6-2,11-7-3)12-8-4;8-6(9,10)4-2-1-3-5-7(11,12)17(14,15)16-13/h5-8H,1-4,9-12H2;1-5H2/q+1; |
| InChIKey | ZEHDEXGYPQKVPG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|