About bis(4,4-dihexylpyridin-1-amine);octane
bis(4,4-dihexylpyridin-1-amine);octane (PubChem CID 175314408) has the molecular formula C42H82N4
and a molecular weight of 643.15 g/mol. Its IUPAC name is bis(4,4-dihexylpyridin-1-amine);octane.
Molecular Properties
| Compound Name | bis(4,4-dihexylpyridin-1-amine);octane |
| PubChem CID | 175314408 |
| Molecular Formula | C42H82N4 |
| Molecular Weight | 643.15 g/mol |
| Exact Mass | 642.65 |
| IUPAC Name | bis(4,4-dihexylpyridin-1-amine);octane |
| SMILES | CCCCCCC1(CCCCCC)C=CN(N)C=C1.CCCCCCC1(CCCCCC)C=CN(N)C=C1.CCCCCCCC |
| InChI | InChI=1S/2C17H32N2.C8H18/c2*1-3-5-7-9-11-17(12-10-8-6-4-2)13-15-19(18)16-14-17;1-3-5-7-8-6-4-2/h2*13-16H,3-12,18H2,1-2H3;3-8H2,1-2H3 |
| InChIKey | FUDIHPNQJIAYJU-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.15 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze bis(4,4-dihexylpyridin-1-amine);octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,4-dihexylpyridin-1-amine);octane?
The IUPAC name of bis(4,4-dihexylpyridin-1-amine);octane (CID 175314408) is bis(4,4-dihexylpyridin-1-amine);octane.
What is the SMILES notation for bis(4,4-dihexylpyridin-1-amine);octane?
The canonical SMILES for bis(4,4-dihexylpyridin-1-amine);octane is CCCCCCC1(CCCCCC)C=CN(N)C=C1.CCCCCCC1(CCCCCC)C=CN(N)C=C1.CCCCCCCC.
What is the InChIKey of bis(4,4-dihexylpyridin-1-amine);octane?
The InChIKey is FUDIHPNQJIAYJU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H32N2.C8H18/c2*1-3-5-7-9-11-17(12-10-8-6-4-2)13-15-19(18)16-14-17;1-3-5-7-8-6-4-2/h2*13-16H,3-12,18H2,1-2H3;3-8H2,1-2H3.
What are the key properties of bis(4,4-dihexylpyridin-1-amine);octane?
bis(4,4-dihexylpyridin-1-amine);octane has a molecular weight of 643.15 g/mol, XLogP of 13.63, 25 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,4-dihexylpyridin-1-amine);octane is sourced from PubChem (CID 175314408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).