About bromomethylbenzene;pyrrole-2,5-dione
bromomethylbenzene;pyrrole-2,5-dione (PubChem CID 175314529) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is bromomethylbenzene;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | bromomethylbenzene;pyrrole-2,5-dione |
| PubChem CID | 175314529 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | bromomethylbenzene;pyrrole-2,5-dione |
| SMILES | BrCc1ccccc1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C7H7Br.C4H3NO2/c8-6-7-4-2-1-3-5-7;6-3-1-2-4(7)5-3/h1-5H,6H2;1-2H,(H,5,6,7) |
| InChIKey | INDFVBBTTZVNLF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bromomethylbenzene;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethylbenzene;pyrrole-2,5-dione?
The IUPAC name of bromomethylbenzene;pyrrole-2,5-dione (CID 175314529) is bromomethylbenzene;pyrrole-2,5-dione.
What is the SMILES notation for bromomethylbenzene;pyrrole-2,5-dione?
The canonical SMILES for bromomethylbenzene;pyrrole-2,5-dione is BrCc1ccccc1.O=C1C=CC(=O)N1.
What is the InChIKey of bromomethylbenzene;pyrrole-2,5-dione?
The InChIKey is INDFVBBTTZVNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br.C4H3NO2/c8-6-7-4-2-1-3-5-7;6-3-1-2-4(7)5-3/h1-5H,6H2;1-2H,(H,5,6,7).
What are the key properties of bromomethylbenzene;pyrrole-2,5-dione?
bromomethylbenzene;pyrrole-2,5-dione has a molecular weight of 268.11 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethylbenzene;pyrrole-2,5-dione is sourced from PubChem (CID 175314529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).