About hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine
hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine (PubChem CID 175316091) has the molecular formula C2H6NO4+
and a molecular weight of 108.07 g/mol. Its IUPAC name is hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine.
Molecular Properties
| Compound Name | hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine |
| PubChem CID | 175316091 |
| Molecular Formula | C2H6NO4+ |
| Molecular Weight | 108.07 g/mol |
| Exact Mass | 108.03 |
| IUPAC Name | hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine |
| SMILES | COC1(ON)OO1.[H+] |
| InChI | InChI=1S/C2H5NO4/c1-4-2(5-3)6-7-2/h3H2,1H3/p+1 |
| InChIKey | IBFLJEUJGYNZNU-UHFFFAOYSA-O |
| XLogP | -0.79 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.07 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine?
The IUPAC name of hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine (CID 175316091) is hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine.
What is the SMILES notation for hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine?
The canonical SMILES for hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine is COC1(ON)OO1.[H+].
What is the InChIKey of hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine?
The InChIKey is IBFLJEUJGYNZNU-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H5NO4/c1-4-2(5-3)6-7-2/h3H2,1H3/p+1.
What are the key properties of hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine?
hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine has a molecular weight of 108.07 g/mol, XLogP of -0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;O-(3-methoxydioxiran-3-yl)hydroxylamine is sourced from PubChem (CID 175316091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).