About lead(2+);stibane;sulfate
lead(2+);stibane;sulfate (PubChem CID 175316158) has the molecular formula H3O4PbSSb
and a molecular weight of 428.05 g/mol. Its IUPAC name is lead(2+);stibane;sulfate.
Molecular Properties
| Compound Name | lead(2+);stibane;sulfate |
| PubChem CID | 175316158 |
| Molecular Formula | H3O4PbSSb |
| Molecular Weight | 428.05 g/mol |
| Exact Mass | 427.86 |
| IUPAC Name | lead(2+);stibane;sulfate |
| SMILES | O=S(=O)([O-])[O-].[Pb+2].[SbH3] |
| InChI | InChI=1S/H2O4S.Pb.Sb.3H/c1-5(2,3)4;;;;;/h(H2,1,2,3,4);;;;;/q;+2;;;;/p-2 |
| InChIKey | KAJQZHUAGZSFMB-UHFFFAOYSA-L |
| XLogP | -2.90 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.05 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze lead(2+);stibane;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+);stibane;sulfate?
The IUPAC name of lead(2+);stibane;sulfate (CID 175316158) is lead(2+);stibane;sulfate.
What is the SMILES notation for lead(2+);stibane;sulfate?
The canonical SMILES for lead(2+);stibane;sulfate is O=S(=O)([O-])[O-].[Pb+2].[SbH3].
What is the InChIKey of lead(2+);stibane;sulfate?
The InChIKey is KAJQZHUAGZSFMB-UHFFFAOYSA-L. The full InChI is InChI=1S/H2O4S.Pb.Sb.3H/c1-5(2,3)4;;;;;/h(H2,1,2,3,4);;;;;/q;+2;;;;/p-2.
What are the key properties of lead(2+);stibane;sulfate?
lead(2+);stibane;sulfate has a molecular weight of 428.05 g/mol, XLogP of -2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+);stibane;sulfate is sourced from PubChem (CID 175316158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).