About ethanol;1-phenyl-1-propan-2-yloxyguanidine
ethanol;1-phenyl-1-propan-2-yloxyguanidine (PubChem CID 175317381) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is ethanol;1-phenyl-1-propan-2-yloxyguanidine.
Molecular Properties
| Compound Name | ethanol;1-phenyl-1-propan-2-yloxyguanidine |
| PubChem CID | 175317381 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | ethanol;1-phenyl-1-propan-2-yloxyguanidine |
| SMILES | CCO.[H]/N=C(\N)N(OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C10H15N3O.C2H6O/c1-8(2)14-13(10(11)12)9-6-4-3-5-7-9;1-2-3/h3-8H,1-2H3,(H3,11,12);3H,2H2,1H3 |
| InChIKey | IQOWPSIPZLNIRB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;1-phenyl-1-propan-2-yloxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-phenyl-1-propan-2-yloxyguanidine?
The IUPAC name of ethanol;1-phenyl-1-propan-2-yloxyguanidine (CID 175317381) is ethanol;1-phenyl-1-propan-2-yloxyguanidine.
What is the SMILES notation for ethanol;1-phenyl-1-propan-2-yloxyguanidine?
The canonical SMILES for ethanol;1-phenyl-1-propan-2-yloxyguanidine is CCO.[H]/N=C(\N)N(OC(C)C)c1ccccc1.
What is the InChIKey of ethanol;1-phenyl-1-propan-2-yloxyguanidine?
The InChIKey is IQOWPSIPZLNIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O.C2H6O/c1-8(2)14-13(10(11)12)9-6-4-3-5-7-9;1-2-3/h3-8H,1-2H3,(H3,11,12);3H,2H2,1H3.
What are the key properties of ethanol;1-phenyl-1-propan-2-yloxyguanidine?
ethanol;1-phenyl-1-propan-2-yloxyguanidine has a molecular weight of 239.32 g/mol, XLogP of 1.73, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-phenyl-1-propan-2-yloxyguanidine is sourced from PubChem (CID 175317381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).