About ethane;3-hydroxypyrrolidine-2,5-dione
ethane;3-hydroxypyrrolidine-2,5-dione (PubChem CID 175317402) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is ethane;3-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | ethane;3-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 175317402 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | ethane;3-hydroxypyrrolidine-2,5-dione |
| SMILES | CC.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C4H5NO3.C2H6/c6-2-1-3(7)5-4(2)8;1-2/h2,6H,1H2,(H,5,7,8);1-2H3 |
| InChIKey | IEQBUWBJGMCDHN-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-hydroxypyrrolidine-2,5-dione?
The IUPAC name of ethane;3-hydroxypyrrolidine-2,5-dione (CID 175317402) is ethane;3-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for ethane;3-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for ethane;3-hydroxypyrrolidine-2,5-dione is CC.O=C1CC(O)C(=O)N1.
What is the InChIKey of ethane;3-hydroxypyrrolidine-2,5-dione?
The InChIKey is IEQBUWBJGMCDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.C2H6/c6-2-1-3(7)5-4(2)8;1-2/h2,6H,1H2,(H,5,7,8);1-2H3.
What are the key properties of ethane;3-hydroxypyrrolidine-2,5-dione?
ethane;3-hydroxypyrrolidine-2,5-dione has a molecular weight of 145.16 g/mol, XLogP of -0.58, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 175317402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).