About calcium;1,2-dihydroquinoline;carbonate
calcium;1,2-dihydroquinoline;carbonate (PubChem CID 175318254) has the molecular formula C10H9CaNO3
and a molecular weight of 231.26 g/mol. Its IUPAC name is calcium;1,2-dihydroquinoline;carbonate.
Molecular Properties
| Compound Name | calcium;1,2-dihydroquinoline;carbonate |
| PubChem CID | 175318254 |
| Molecular Formula | C10H9CaNO3 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | calcium;1,2-dihydroquinoline;carbonate |
| SMILES | C1=Cc2ccccc2NC1.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C9H9N.CH2O3.Ca/c1-2-6-9-8(4-1)5-3-7-10-9;2-1(3)4;/h1-6,10H,7H2;(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | ZPYWDBMZQANXRB-UHFFFAOYSA-L |
| XLogP | -0.70 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium;1,2-dihydroquinoline;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;1,2-dihydroquinoline;carbonate?
The IUPAC name of calcium;1,2-dihydroquinoline;carbonate (CID 175318254) is calcium;1,2-dihydroquinoline;carbonate.
What is the SMILES notation for calcium;1,2-dihydroquinoline;carbonate?
The canonical SMILES for calcium;1,2-dihydroquinoline;carbonate is C1=Cc2ccccc2NC1.O=C([O-])[O-].[Ca+2].
What is the InChIKey of calcium;1,2-dihydroquinoline;carbonate?
The InChIKey is ZPYWDBMZQANXRB-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H9N.CH2O3.Ca/c1-2-6-9-8(4-1)5-3-7-10-9;2-1(3)4;/h1-6,10H,7H2;(H2,2,3,4);/q;;+2/p-2.
What are the key properties of calcium;1,2-dihydroquinoline;carbonate?
calcium;1,2-dihydroquinoline;carbonate has a molecular weight of 231.26 g/mol, XLogP of -0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;1,2-dihydroquinoline;carbonate is sourced from PubChem (CID 175318254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).