C9H12F5NO — CID 175318342
2-(2,3,4,5,5-pentafluoropentoxy)butanenitrile (PubChem CID 175318342) has the molecular formula C9H12F5NO and a molecular weight of 245.19 g/mol. Its IUPAC name is 2-(2,3,4,5,5-pentafluoropentoxy)butanenitrile.
| Compound Name | 2-(2,3,4,5,5-pentafluoropentoxy)butanenitrile |
|---|---|
| PubChem CID | 175318342 |
| Molecular Formula | C9H12F5NO |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-(2,3,4,5,5-pentafluoropentoxy)butanenitrile |
| SMILES | CCC(C#N)OCC(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C9H12F5NO/c1-2-5(3-15)16-4-6(10)7(11)8(12)9(13)14/h5-9H,2,4H2,1H3 |
| InChIKey | OKUNJXDPGJIVEW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |