C22H23NOS — CID 175318489
3,4,4a,12a-tetrahydro-2H-chrysen-1-one;1H-pyrrole;sulfane (PubChem CID 175318489) has the molecular formula C22H23NOS and a molecular weight of 349.50 g/mol. Its IUPAC name is 3,4,4a,12a-tetrahydro-2H-chrysen-1-one;1H-pyrrole;sulfane.
| Compound Name | 3,4,4a,12a-tetrahydro-2H-chrysen-1-one;1H-pyrrole;sulfane |
|---|---|
| PubChem CID | 175318489 |
| Molecular Formula | C22H23NOS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3,4,4a,12a-tetrahydro-2H-chrysen-1-one;1H-pyrrole;sulfane |
| SMILES | O=C1CCCC2c3ccc4ccccc4c3C=CC12.S.c1cc[nH]c1 |
| InChI | InChI=1S/C18H16O.C4H5N.H2S/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;1-2-4-5-3-1;/h1-2,4-5,8-11,14,17H,3,6-7H2;1-5H;1H2 |
| InChIKey | BPERBRBXLXKBBI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |