C10H14F5NO — CID 175318838
2-(2,3,4,5,6-pentafluorohexoxy)butanenitrile (PubChem CID 175318838) has the molecular formula C10H14F5NO and a molecular weight of 259.22 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorohexoxy)butanenitrile.
| Compound Name | 2-(2,3,4,5,6-pentafluorohexoxy)butanenitrile |
|---|---|
| PubChem CID | 175318838 |
| Molecular Formula | C10H14F5NO |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorohexoxy)butanenitrile |
| SMILES | CCC(C#N)OCC(F)C(F)C(F)C(F)CF |
| InChI | InChI=1S/C10H14F5NO/c1-2-6(4-16)17-5-8(13)10(15)9(14)7(12)3-11/h6-10H,2-3,5H2,1H3 |
| InChIKey | AIALLKJYJZGNIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |