About [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol
[(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol (PubChem CID 175319242) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol |
| PubChem CID | 175319242 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol |
| SMILES | CC(C)CN1CC(F)(F)C[C@H]1CO |
| InChI | InChI=1S/C9H17F2NO/c1-7(2)4-12-6-9(10,11)3-8(12)5-13/h7-8,13H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | KAUQEAIUTKCJRZ-QMMMGPOBSA-N |
| XLogP | 1.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol?
The IUPAC name of [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol (CID 175319242) is [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol is CC(C)CN1CC(F)(F)C[C@H]1CO.
What is the InChIKey of [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol?
The InChIKey is KAUQEAIUTKCJRZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H17F2NO/c1-7(2)4-12-6-9(10,11)3-8(12)5-13/h7-8,13H,3-6H2,1-2H3/t8-/m0/s1.
What are the key properties of [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol?
[(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol has a molecular weight of 193.24 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4,4-difluoro-1-(2-methylpropyl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 175319242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).