About 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol
1-(2,3-dihydro-1H-imidazol-4-yl)ethanol (PubChem CID 175319554) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol |
| PubChem CID | 175319554 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol |
| SMILES | CC(O)C1=CNCN1 |
| InChI | InChI=1S/C5H10N2O/c1-4(8)5-2-6-3-7-5/h2,4,6-8H,3H2,1H3 |
| InChIKey | XUBODKHIAXCCAJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol?
The IUPAC name of 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol (CID 175319554) is 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol.
What is the SMILES notation for 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol?
The canonical SMILES for 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol is CC(O)C1=CNCN1.
What is the InChIKey of 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol?
The InChIKey is XUBODKHIAXCCAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-4(8)5-2-6-3-7-5/h2,4,6-8H,3H2,1H3.
What are the key properties of 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol?
1-(2,3-dihydro-1H-imidazol-4-yl)ethanol has a molecular weight of 114.15 g/mol, XLogP of -0.64, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-imidazol-4-yl)ethanol is sourced from PubChem (CID 175319554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).