About tert-butyl 2-fluorosulfanylbenzoate
tert-butyl 2-fluorosulfanylbenzoate (PubChem CID 175320456) has the molecular formula C11H13FO2S
and a molecular weight of 228.29 g/mol. Its IUPAC name is tert-butyl 2-fluorosulfanylbenzoate.
Molecular Properties
| Compound Name | tert-butyl 2-fluorosulfanylbenzoate |
| PubChem CID | 175320456 |
| Molecular Formula | C11H13FO2S |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | tert-butyl 2-fluorosulfanylbenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccccc1SF |
| InChI | InChI=1S/C11H13FO2S/c1-11(2,3)14-10(13)8-6-4-5-7-9(8)15-12/h4-7H,1-3H3 |
| InChIKey | REOKMAJTHFVDOM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-fluorosulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-fluorosulfanylbenzoate?
The IUPAC name of tert-butyl 2-fluorosulfanylbenzoate (CID 175320456) is tert-butyl 2-fluorosulfanylbenzoate.
What is the SMILES notation for tert-butyl 2-fluorosulfanylbenzoate?
The canonical SMILES for tert-butyl 2-fluorosulfanylbenzoate is CC(C)(C)OC(=O)c1ccccc1SF.
What is the InChIKey of tert-butyl 2-fluorosulfanylbenzoate?
The InChIKey is REOKMAJTHFVDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO2S/c1-11(2,3)14-10(13)8-6-4-5-7-9(8)15-12/h4-7H,1-3H3.
What are the key properties of tert-butyl 2-fluorosulfanylbenzoate?
tert-butyl 2-fluorosulfanylbenzoate has a molecular weight of 228.29 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-fluorosulfanylbenzoate is sourced from PubChem (CID 175320456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).