C16H30N2O2 — CID 175320466
1,2-bis(4-aminocyclohexyl)ethyl acetate (PubChem CID 175320466) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,2-bis(4-aminocyclohexyl)ethyl acetate.
| Compound Name | 1,2-bis(4-aminocyclohexyl)ethyl acetate |
|---|---|
| PubChem CID | 175320466 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1,2-bis(4-aminocyclohexyl)ethyl acetate |
| SMILES | CC(=O)OC(CC1CCC(N)CC1)C1CCC(N)CC1 |
| InChI | InChI=1S/C16H30N2O2/c1-11(19)20-16(13-4-8-15(18)9-5-13)10-12-2-6-14(17)7-3-12/h12-16H,2-10,17-18H2,1H3 |
| InChIKey | PRSDNTBBPHCQAR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |