About [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate
[(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate (PubChem CID 175320906) has the molecular formula C10H21NO4
and a molecular weight of 219.28 g/mol. Its IUPAC name is [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate |
| PubChem CID | 175320906 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H](CO)C(C)(C)O |
| InChI | InChI=1S/C10H21NO4/c1-9(2,3)11-8(13)15-7(6-12)10(4,5)14/h7,12,14H,6H2,1-5H3,(H,11,13)/t7-/m1/s1 |
| InChIKey | QKXMEMKARIYPDJ-SSDOTTSWSA-N |
| XLogP | 0.64 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate?
The IUPAC name of [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate (CID 175320906) is [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate.
What is the SMILES notation for [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate?
The canonical SMILES for [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate is CC(C)(C)NC(=O)O[C@H](CO)C(C)(C)O.
What is the InChIKey of [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate?
The InChIKey is QKXMEMKARIYPDJ-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H21NO4/c1-9(2,3)11-8(13)15-7(6-12)10(4,5)14/h7,12,14H,6H2,1-5H3,(H,11,13)/t7-/m1/s1.
What are the key properties of [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate?
[(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate has a molecular weight of 219.28 g/mol, XLogP of 0.64, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1,3-dihydroxy-3-methylbutan-2-yl] N-tert-butylcarbamate is sourced from PubChem (CID 175320906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).