About 2,3-bis(thiiran-2-yl)thiirane;hydrate
2,3-bis(thiiran-2-yl)thiirane;hydrate (PubChem CID 175321377) has the molecular formula C6H10OS3
and a molecular weight of 194.35 g/mol. Its IUPAC name is 2,3-bis(thiiran-2-yl)thiirane;hydrate.
Molecular Properties
| Compound Name | 2,3-bis(thiiran-2-yl)thiirane;hydrate |
| PubChem CID | 175321377 |
| Molecular Formula | C6H10OS3 |
| Molecular Weight | 194.35 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | 2,3-bis(thiiran-2-yl)thiirane;hydrate |
| SMILES | C1SC1C1SC1C1CS1.O |
| InChI | InChI=1S/C6H8S3.H2O/c1-3(7-1)5-6(9-5)4-2-8-4;/h3-6H,1-2H2;1H2 |
| InChIKey | XEZBYFISULLTLG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(thiiran-2-yl)thiirane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(thiiran-2-yl)thiirane;hydrate?
The IUPAC name of 2,3-bis(thiiran-2-yl)thiirane;hydrate (CID 175321377) is 2,3-bis(thiiran-2-yl)thiirane;hydrate.
What is the SMILES notation for 2,3-bis(thiiran-2-yl)thiirane;hydrate?
The canonical SMILES for 2,3-bis(thiiran-2-yl)thiirane;hydrate is C1SC1C1SC1C1CS1.O.
What is the InChIKey of 2,3-bis(thiiran-2-yl)thiirane;hydrate?
The InChIKey is XEZBYFISULLTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8S3.H2O/c1-3(7-1)5-6(9-5)4-2-8-4;/h3-6H,1-2H2;1H2.
What are the key properties of 2,3-bis(thiiran-2-yl)thiirane;hydrate?
2,3-bis(thiiran-2-yl)thiirane;hydrate has a molecular weight of 194.35 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(thiiran-2-yl)thiirane;hydrate is sourced from PubChem (CID 175321377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).