About 1-ethynyl-3,5-difluorobenzene;hydrobromide
1-ethynyl-3,5-difluorobenzene;hydrobromide (PubChem CID 175321669) has the molecular formula C8H5BrF2
and a molecular weight of 219.03 g/mol. Its IUPAC name is 1-ethynyl-3,5-difluorobenzene;hydrobromide.
Molecular Properties
| Compound Name | 1-ethynyl-3,5-difluorobenzene;hydrobromide |
| PubChem CID | 175321669 |
| Molecular Formula | C8H5BrF2 |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 1-ethynyl-3,5-difluorobenzene;hydrobromide |
| SMILES | Br.C#Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H4F2.BrH/c1-2-6-3-7(9)5-8(10)4-6;/h1,3-5H;1H |
| InChIKey | FHMNPKAQMRNGGS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-3,5-difluorobenzene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-3,5-difluorobenzene;hydrobromide?
The IUPAC name of 1-ethynyl-3,5-difluorobenzene;hydrobromide (CID 175321669) is 1-ethynyl-3,5-difluorobenzene;hydrobromide.
What is the SMILES notation for 1-ethynyl-3,5-difluorobenzene;hydrobromide?
The canonical SMILES for 1-ethynyl-3,5-difluorobenzene;hydrobromide is Br.C#Cc1cc(F)cc(F)c1.
What is the InChIKey of 1-ethynyl-3,5-difluorobenzene;hydrobromide?
The InChIKey is FHMNPKAQMRNGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F2.BrH/c1-2-6-3-7(9)5-8(10)4-6;/h1,3-5H;1H.
What are the key properties of 1-ethynyl-3,5-difluorobenzene;hydrobromide?
1-ethynyl-3,5-difluorobenzene;hydrobromide has a molecular weight of 219.03 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-3,5-difluorobenzene;hydrobromide is sourced from PubChem (CID 175321669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).