About ethyl carbonochloridate;propanoic acid
ethyl carbonochloridate;propanoic acid (PubChem CID 175322247) has the molecular formula C6H11ClO4
and a molecular weight of 182.60 g/mol. Its IUPAC name is ethyl carbonochloridate;propanoic acid.
Molecular Properties
| Compound Name | ethyl carbonochloridate;propanoic acid |
| PubChem CID | 175322247 |
| Molecular Formula | C6H11ClO4 |
| Molecular Weight | 182.60 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | ethyl carbonochloridate;propanoic acid |
| SMILES | CCC(=O)O.CCOC(=O)Cl |
| InChI | InChI=1S/C3H5ClO2.C3H6O2/c1-2-6-3(4)5;1-2-3(4)5/h2H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | VKRCXWFZHASOJV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbonochloridate;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbonochloridate;propanoic acid?
The IUPAC name of ethyl carbonochloridate;propanoic acid (CID 175322247) is ethyl carbonochloridate;propanoic acid.
What is the SMILES notation for ethyl carbonochloridate;propanoic acid?
The canonical SMILES for ethyl carbonochloridate;propanoic acid is CCC(=O)O.CCOC(=O)Cl.
What is the InChIKey of ethyl carbonochloridate;propanoic acid?
The InChIKey is VKRCXWFZHASOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO2.C3H6O2/c1-2-6-3(4)5;1-2-3(4)5/h2H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of ethyl carbonochloridate;propanoic acid?
ethyl carbonochloridate;propanoic acid has a molecular weight of 182.60 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbonochloridate;propanoic acid is sourced from PubChem (CID 175322247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).