C42H54N8 — CID 175322741
3-pyrrol-1-yl-1-[2,4,5-tris(3-pyrrol-1-ylpiperidin-1-yl)phenyl]piperidine (PubChem CID 175322741) has the molecular formula C42H54N8 and a molecular weight of 670.95 g/mol. Its IUPAC name is 3-pyrrol-1-yl-1-[2,4,5-tris(3-pyrrol-1-ylpiperidin-1-yl)phenyl]piperidine.
| Compound Name | 3-pyrrol-1-yl-1-[2,4,5-tris(3-pyrrol-1-ylpiperidin-1-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 175322741 |
| Molecular Formula | C42H54N8 |
| Molecular Weight | 670.95 g/mol |
| Exact Mass | 670.45 |
| IUPAC Name | 3-pyrrol-1-yl-1-[2,4,5-tris(3-pyrrol-1-ylpiperidin-1-yl)phenyl]piperidine |
| SMILES | c1ccn(C2CCCN(c3cc(N4CCCC(n5cccc5)C4)c(N4CCCC(n5cccc5)C4)cc3N3CCCC(n4cccc4)C3)C2)c1 |
| InChI | InChI=1S/C42H54N8/c1-2-18-43(17-1)35-13-9-25-47(31-35)39-29-41(49-27-11-15-37(33-49)45-21-5-6-22-45)42(50-28-12-16-38(34-50)46-23-7-8-24-46)30-40(39)48-26-10-14-36(32-48)44-19-3-4-20-44/h1-8,17-24,29-30,35-38H,9-16,25-28,31-34H2 |
| InChIKey | PYJRCPDEPFXNCL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 32.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.95 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |