C24H40O2 — CID 175322908
3-(4-tert-butylphenyl)-2-methylpropanal;2,6-dimethyloct-7-en-2-ol (PubChem CID 175322908) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-methylpropanal;2,6-dimethyloct-7-en-2-ol.
| Compound Name | 3-(4-tert-butylphenyl)-2-methylpropanal;2,6-dimethyloct-7-en-2-ol |
|---|---|
| PubChem CID | 175322908 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-methylpropanal;2,6-dimethyloct-7-en-2-ol |
| SMILES | C=CC(C)CCCC(C)(C)O.CC(C=O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H20O.C10H20O/c1-11(10-15)9-12-5-7-13(8-6-12)14(2,3)4;1-5-9(2)7-6-8-10(3,4)11/h5-8,10-11H,9H2,1-4H3;5,9,11H,1,6-8H2,2-4H3 |
| InChIKey | MEHHFDFNYVLCBL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|