About 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene
1,2-bis(prop-2-enyl)-3,6-dihydrochrysene (PubChem CID 175323139) has the molecular formula C24H22
and a molecular weight of 310.44 g/mol. Its IUPAC name is 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene.
Molecular Properties
| Compound Name | 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene |
| PubChem CID | 175323139 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene |
| SMILES | C=CCC1=C(CC=C)c2ccc3c(c2=CC1)=CCc1ccccc1-3 |
| InChI | InChI=1S/C24H22/c1-3-7-17-11-13-23-21(19(17)8-4-2)15-16-22-20-10-6-5-9-18(20)12-14-24(22)23/h3-6,9-10,13-16H,1-2,7-8,11-12H2 |
| InChIKey | VAJHPWXQLHGOJQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene?
The IUPAC name of 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene (CID 175323139) is 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene.
What is the SMILES notation for 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene?
The canonical SMILES for 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene is C=CCC1=C(CC=C)c2ccc3c(c2=CC1)=CCc1ccccc1-3.
What is the InChIKey of 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene?
The InChIKey is VAJHPWXQLHGOJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22/c1-3-7-17-11-13-23-21(19(17)8-4-2)15-16-22-20-10-6-5-9-18(20)12-14-24(22)23/h3-6,9-10,13-16H,1-2,7-8,11-12H2.
What are the key properties of 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene?
1,2-bis(prop-2-enyl)-3,6-dihydrochrysene has a molecular weight of 310.44 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(prop-2-enyl)-3,6-dihydrochrysene is sourced from PubChem (CID 175323139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).