About bis(trichloromethyl) carbonate;hexane
bis(trichloromethyl) carbonate;hexane (PubChem CID 175323267) has the molecular formula C9H14Cl6O3
and a molecular weight of 382.93 g/mol. Its IUPAC name is bis(trichloromethyl) carbonate;hexane.
Molecular Properties
| Compound Name | bis(trichloromethyl) carbonate;hexane |
| PubChem CID | 175323267 |
| Molecular Formula | C9H14Cl6O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | bis(trichloromethyl) carbonate;hexane |
| SMILES | CCCCCC.O=C(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H14.C3Cl6O3/c1-3-5-6-4-2;4-2(5,6)11-1(10)12-3(7,8)9/h3-6H2,1-2H3; |
| InChIKey | GESZXLIXWYXWCC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(trichloromethyl) carbonate;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trichloromethyl) carbonate;hexane?
The IUPAC name of bis(trichloromethyl) carbonate;hexane (CID 175323267) is bis(trichloromethyl) carbonate;hexane.
What is the SMILES notation for bis(trichloromethyl) carbonate;hexane?
The canonical SMILES for bis(trichloromethyl) carbonate;hexane is CCCCCC.O=C(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl.
What is the InChIKey of bis(trichloromethyl) carbonate;hexane?
The InChIKey is GESZXLIXWYXWCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C3Cl6O3/c1-3-5-6-4-2;4-2(5,6)11-1(10)12-3(7,8)9/h3-6H2,1-2H3;.
What are the key properties of bis(trichloromethyl) carbonate;hexane?
bis(trichloromethyl) carbonate;hexane has a molecular weight of 382.93 g/mol, XLogP of 6.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trichloromethyl) carbonate;hexane is sourced from PubChem (CID 175323267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).