About 2-ethyl-2-methyl-4H-1,3-dioxine
2-ethyl-2-methyl-4H-1,3-dioxine (PubChem CID 175323270) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-ethyl-2-methyl-4H-1,3-dioxine.
Molecular Properties
| Compound Name | 2-ethyl-2-methyl-4H-1,3-dioxine |
| PubChem CID | 175323270 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2-ethyl-2-methyl-4H-1,3-dioxine |
| SMILES | CCC1(C)OC=CCO1 |
| InChI | InChI=1S/C7H12O2/c1-3-7(2)8-5-4-6-9-7/h4-5H,3,6H2,1-2H3 |
| InChIKey | HQSNYHMCGAXOAV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2-methyl-4H-1,3-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-methyl-4H-1,3-dioxine?
The IUPAC name of 2-ethyl-2-methyl-4H-1,3-dioxine (CID 175323270) is 2-ethyl-2-methyl-4H-1,3-dioxine.
What is the SMILES notation for 2-ethyl-2-methyl-4H-1,3-dioxine?
The canonical SMILES for 2-ethyl-2-methyl-4H-1,3-dioxine is CCC1(C)OC=CCO1.
What is the InChIKey of 2-ethyl-2-methyl-4H-1,3-dioxine?
The InChIKey is HQSNYHMCGAXOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-3-7(2)8-5-4-6-9-7/h4-5H,3,6H2,1-2H3.
What are the key properties of 2-ethyl-2-methyl-4H-1,3-dioxine?
2-ethyl-2-methyl-4H-1,3-dioxine has a molecular weight of 128.17 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-methyl-4H-1,3-dioxine is sourced from PubChem (CID 175323270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).