About bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene
bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene (PubChem CID 175323419) has the molecular formula C16H22O4
and a molecular weight of 278.35 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene |
| PubChem CID | 175323419 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene |
| SMILES | C1=C2CCC(C1)C2.COOC(OOC)c1ccccc1 |
| InChI | InChI=1S/C9H12O4.C7H10/c1-10-12-9(13-11-2)8-6-4-3-5-7-8;1-2-7-4-3-6(1)5-7/h3-7,9H,1-2H3;1,7H,2-5H2 |
| InChIKey | RXQFJVZCCIVYSG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene?
The IUPAC name of bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene (CID 175323419) is bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene.
What is the SMILES notation for bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene?
The canonical SMILES for bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene is C1=C2CCC(C1)C2.COOC(OOC)c1ccccc1.
What is the InChIKey of bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene?
The InChIKey is RXQFJVZCCIVYSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4.C7H10/c1-10-12-9(13-11-2)8-6-4-3-5-7-8;1-2-7-4-3-6(1)5-7/h3-7,9H,1-2H3;1,7H,2-5H2.
What are the key properties of bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene?
bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene has a molecular weight of 278.35 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-1-ene;bis(methylperoxy)methylbenzene is sourced from PubChem (CID 175323419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).