About cyclobutane;hydroxymethyl(trimethyl)azanium;iodide
cyclobutane;hydroxymethyl(trimethyl)azanium;iodide (PubChem CID 175323903) has the molecular formula C8H20INO
and a molecular weight of 273.16 g/mol. Its IUPAC name is cyclobutane;hydroxymethyl(trimethyl)azanium;iodide.
Molecular Properties
| Compound Name | cyclobutane;hydroxymethyl(trimethyl)azanium;iodide |
| PubChem CID | 175323903 |
| Molecular Formula | C8H20INO |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | cyclobutane;hydroxymethyl(trimethyl)azanium;iodide |
| SMILES | C1CCC1.C[N+](C)(C)CO.[I-] |
| InChI | InChI=1S/C4H12NO.C4H8.HI/c1-5(2,3)4-6;1-2-4-3-1;/h6H,4H2,1-3H3;1-4H2;1H/q+1;;/p-1 |
| InChIKey | ZUDYKINMZIKIEG-UHFFFAOYSA-M |
| XLogP | -1.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane;hydroxymethyl(trimethyl)azanium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;hydroxymethyl(trimethyl)azanium;iodide?
The IUPAC name of cyclobutane;hydroxymethyl(trimethyl)azanium;iodide (CID 175323903) is cyclobutane;hydroxymethyl(trimethyl)azanium;iodide.
What is the SMILES notation for cyclobutane;hydroxymethyl(trimethyl)azanium;iodide?
The canonical SMILES for cyclobutane;hydroxymethyl(trimethyl)azanium;iodide is C1CCC1.C[N+](C)(C)CO.[I-].
What is the InChIKey of cyclobutane;hydroxymethyl(trimethyl)azanium;iodide?
The InChIKey is ZUDYKINMZIKIEG-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H12NO.C4H8.HI/c1-5(2,3)4-6;1-2-4-3-1;/h6H,4H2,1-3H3;1-4H2;1H/q+1;;/p-1.
What are the key properties of cyclobutane;hydroxymethyl(trimethyl)azanium;iodide?
cyclobutane;hydroxymethyl(trimethyl)azanium;iodide has a molecular weight of 273.16 g/mol, XLogP of -1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;hydroxymethyl(trimethyl)azanium;iodide is sourced from PubChem (CID 175323903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).