C7H13BF4N3- — CID 175323912
azane;5,6,7,8-tetrahydroimidazo[1,2-a]pyridine;tetrafluoroborate (PubChem CID 175323912) has the molecular formula C7H13BF4N3- and a molecular weight of 226.01 g/mol. Its IUPAC name is azane;5,6,7,8-tetrahydroimidazo[1,2-a]pyridine;tetrafluoroborate.
| Compound Name | azane;5,6,7,8-tetrahydroimidazo[1,2-a]pyridine;tetrafluoroborate |
|---|---|
| PubChem CID | 175323912 |
| Molecular Formula | C7H13BF4N3- |
| Molecular Weight | 226.01 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | azane;5,6,7,8-tetrahydroimidazo[1,2-a]pyridine;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N.c1cn2c(n1)CCCC2 |
| InChI | InChI=1S/C7H10N2.BF4.H3N/c1-2-5-9-6-4-8-7(9)3-1;2-1(3,4)5;/h4,6H,1-3,5H2;;1H3/q;-1; |
| InChIKey | PUIGEWFSPBDLKK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.01 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|