About 1-nitrobut-1-ene-2-thiol
1-nitrobut-1-ene-2-thiol (PubChem CID 175323961) has the molecular formula C4H7NO2S
and a molecular weight of 133.17 g/mol. Its IUPAC name is 1-nitrobut-1-ene-2-thiol.
Molecular Properties
| Compound Name | 1-nitrobut-1-ene-2-thiol |
| PubChem CID | 175323961 |
| Molecular Formula | C4H7NO2S |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.02 |
| IUPAC Name | 1-nitrobut-1-ene-2-thiol |
| SMILES | CCC(S)=C[N+](=O)[O-] |
| InChI | InChI=1S/C4H7NO2S/c1-2-4(8)3-5(6)7/h3,8H,2H2,1H3 |
| InChIKey | MHFKENXADCSABE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrobut-1-ene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrobut-1-ene-2-thiol?
The IUPAC name of 1-nitrobut-1-ene-2-thiol (CID 175323961) is 1-nitrobut-1-ene-2-thiol.
What is the SMILES notation for 1-nitrobut-1-ene-2-thiol?
The canonical SMILES for 1-nitrobut-1-ene-2-thiol is CCC(S)=C[N+](=O)[O-].
What is the InChIKey of 1-nitrobut-1-ene-2-thiol?
The InChIKey is MHFKENXADCSABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2S/c1-2-4(8)3-5(6)7/h3,8H,2H2,1H3.
What are the key properties of 1-nitrobut-1-ene-2-thiol?
1-nitrobut-1-ene-2-thiol has a molecular weight of 133.17 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrobut-1-ene-2-thiol is sourced from PubChem (CID 175323961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).