About (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate
(2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate (PubChem CID 175324340) has the molecular formula C12H7N3O3S
and a molecular weight of 273.27 g/mol. Its IUPAC name is (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate |
| PubChem CID | 175324340 |
| Molecular Formula | C12H7N3O3S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate |
| SMILES | N#Cc1ccccc1OC(=O)c1cc(C(N)=O)ns1 |
| InChI | InChI=1S/C12H7N3O3S/c13-6-7-3-1-2-4-9(7)18-12(17)10-5-8(11(14)16)15-19-10/h1-5H,(H2,14,16) |
| InChIKey | NSOPICDGLMUBHK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate?
The IUPAC name of (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate (CID 175324340) is (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate.
What is the SMILES notation for (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate?
The canonical SMILES for (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate is N#Cc1ccccc1OC(=O)c1cc(C(N)=O)ns1.
What is the InChIKey of (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate?
The InChIKey is NSOPICDGLMUBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O3S/c13-6-7-3-1-2-4-9(7)18-12(17)10-5-8(11(14)16)15-19-10/h1-5H,(H2,14,16).
What are the key properties of (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate?
(2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate has a molecular weight of 273.27 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl) 3-carbamoyl-1,2-thiazole-5-carboxylate is sourced from PubChem (CID 175324340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).