About 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid
1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid (PubChem CID 175324603) has the molecular formula C12H15NO4
and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid |
| PubChem CID | 175324603 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(O)N(Cc2ccccc2)C1O |
| InChI | InChI=1S/C12H15NO4/c14-10-6-9(12(16)17)11(15)13(10)7-8-4-2-1-3-5-8/h1-5,9-11,14-15H,6-7H2,(H,16,17) |
| InChIKey | DZXGGRWNAYPKNG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid?
The IUPAC name of 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid (CID 175324603) is 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid is O=C(O)C1CC(O)N(Cc2ccccc2)C1O.
What is the InChIKey of 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid?
The InChIKey is DZXGGRWNAYPKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c14-10-6-9(12(16)17)11(15)13(10)7-8-4-2-1-3-5-8/h1-5,9-11,14-15H,6-7H2,(H,16,17).
What are the key properties of 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid?
1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid has a molecular weight of 237.26 g/mol, XLogP of 0.23, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,5-dihydroxypyrrolidine-3-carboxylic acid is sourced from PubChem (CID 175324603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).