About benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine
benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine (PubChem CID 175324621) has the molecular formula C18H18N2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine |
| PubChem CID | 175324621 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine |
| SMILES | Nc1cccc(C23C=CC=CC2S3)c1N.c1ccccc1 |
| InChI | InChI=1S/C12H12N2S.C6H6/c13-9-5-3-4-8(11(9)14)12-7-2-1-6-10(12)15-12;1-2-4-6-5-3-1/h1-7,10H,13-14H2;1-6H |
| InChIKey | LSWNSFIDVRJJOF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine?
The IUPAC name of benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine (CID 175324621) is benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine.
What is the SMILES notation for benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine?
The canonical SMILES for benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine is Nc1cccc(C23C=CC=CC2S3)c1N.c1ccccc1.
What is the InChIKey of benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine?
The InChIKey is LSWNSFIDVRJJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S.C6H6/c13-9-5-3-4-8(11(9)14)12-7-2-1-6-10(12)15-12;1-2-4-6-5-3-1/h1-7,10H,13-14H2;1-6H.
What are the key properties of benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine?
benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine has a molecular weight of 294.42 g/mol, XLogP of 3.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3-(7-thiabicyclo[4.1.0]hepta-2,4-dien-1-yl)benzene-1,2-diamine is sourced from PubChem (CID 175324621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).