C14H20BrFN2O3 — CID 175324829
2-[(2-bromo-3-fluoro-4-pyridinyl)methylamino]-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid (PubChem CID 175324829) has the molecular formula C14H20BrFN2O3 and a molecular weight of 363.23 g/mol. Its IUPAC name is 2-[(2-bromo-3-fluoro-4-pyridinyl)methylamino]-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid.
| Compound Name | 2-[(2-bromo-3-fluoro-4-pyridinyl)methylamino]-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 175324829 |
| Molecular Formula | C14H20BrFN2O3 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-[(2-bromo-3-fluoro-4-pyridinyl)methylamino]-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| SMILES | CC(C)(C)OCC(C)(NCc1ccnc(Br)c1F)C(=O)O |
| InChI | InChI=1S/C14H20BrFN2O3/c1-13(2,3)21-8-14(4,12(19)20)18-7-9-5-6-17-11(15)10(9)16/h5-6,18H,7-8H2,1-4H3,(H,19,20) |
| InChIKey | PDXITLDGEPCPSN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|